C14H20Cl2N2O2 — CID 56803551
2,4-dichloro-6-[[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]methyl]phenol (PubChem CID 56803551) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 56803551 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2,4-dichloro-6-[[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]methyl]phenol |
| SMILES | COCCN1CCC(NCc2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-20-5-4-18-3-2-12(9-18)17-8-10-6-11(15)7-13(16)14(10)19/h6-7,12,17,19H,2-5,8-9H2,1H3 |
| InChIKey | WZFKIZOIEJTQIW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|