C42H66Cl4N4O3 — CID 142786475
2,4-dichloro-6-[[9-[4-[1-[9-[(3,5-dichloro-2-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonylamino]methyl]phenol (PubChem CID 142786475) has the molecular formula C42H66Cl4N4O3 and a molecular weight of 816.83 g/mol. Its IUPAC name is 2,4-dichloro-6-[[9-[4-[1-[9-[(3,5-dichloro-2-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonylamino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[9-[4-[1-[9-[(3,5-dichloro-2-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonylamino]methyl]phenol |
|---|---|
| PubChem CID | 142786475 |
| Molecular Formula | C42H66Cl4N4O3 |
| Molecular Weight | 816.83 g/mol |
| Exact Mass | 814.39 |
| IUPAC Name | 2,4-dichloro-6-[[9-[4-[1-[9-[(3,5-dichloro-2-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl]oxypiperidin-1-yl]nonylamino]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1CNCCCCCCCCCN1CCC(OC2CCN(CCCCCCCCCNCc3cc(Cl)cc(Cl)c3O)CC2)CC1 |
| InChI | InChI=1S/C42H66Cl4N4O3/c43-35-27-33(41(51)39(45)29-35)31-47-19-11-7-3-1-5-9-13-21-49-23-15-37(16-24-49)53-38-17-25-50(26-18-38)22-14-10-6-2-4-8-12-20-48-32-34-28-36(44)30-40(46)42(34)52/h27-30,37-38,47-48,51-52H,1-26,31-32H2 |
| InChIKey | PPLPGQBDMQEWTB-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.83 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|