C16H25ClN2O — CID 28679958
4-chloro-2-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]phenol (PubChem CID 28679958) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 4-chloro-2-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]phenol.
| Compound Name | 4-chloro-2-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]phenol |
|---|---|
| PubChem CID | 28679958 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-chloro-2-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]phenol |
| SMILES | CC1CCN(CCCNCc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C16H25ClN2O/c1-13-5-9-19(10-6-13)8-2-7-18-12-14-11-15(17)3-4-16(14)20/h3-4,11,13,18,20H,2,5-10,12H2,1H3 |
| InChIKey | HUUXTFWDGGEAGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|