C16H24BrFN2 — CID 28679783
N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-methylpiperidin-1-yl)propan-1-amine (PubChem CID 28679783) has the molecular formula C16H24BrFN2 and a molecular weight of 343.28 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-methylpiperidin-1-yl)propan-1-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-methylpiperidin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 28679783 |
| Molecular Formula | C16H24BrFN2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-methylpiperidin-1-yl)propan-1-amine |
| SMILES | CC1CCN(CCCNCc2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C16H24BrFN2/c1-13-5-9-20(10-6-13)8-2-7-19-12-14-11-15(17)3-4-16(14)18/h3-4,11,13,19H,2,5-10,12H2,1H3 |
| InChIKey | ILODJOQGENKWBX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|