C16H28N4O2 — CID 119126550
1,3-dimethyl-5-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrimidine-2,4-dione (PubChem CID 119126550) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 119126550 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1,3-dimethyl-5-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrimidine-2,4-dione |
| SMILES | CC1CCN(CCCNCc2cn(C)c(=O)n(C)c2=O)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-13-5-9-20(10-6-13)8-4-7-17-11-14-12-18(2)16(22)19(3)15(14)21/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | IHZXMGCSVAVDQD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|