C17H30N4O2 — CID 119126605
5-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 119126605) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 5-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 119126605 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 5-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CN(CCCNCc1cn(C)c(=O)n(C)c1=O)C1CCCCC1 |
| InChI | InChI=1S/C17H30N4O2/c1-19(15-8-5-4-6-9-15)11-7-10-18-12-14-13-20(2)17(23)21(3)16(14)22/h13,15,18H,4-12H2,1-3H3 |
| InChIKey | NREUXEAZJVKZKY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|