C15H27ClN4 — CID 60981096
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 60981096) has the molecular formula C15H27ClN4 and a molecular weight of 298.86 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60981096 |
| Molecular Formula | C15H27ClN4 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1ncc(Cl)n1C)C1CCCCC1 |
| InChI | InChI=1S/C15H27ClN4/c1-19(13-7-4-3-5-8-13)10-6-9-17-12-15-18-11-14(16)20(15)2/h11,13,17H,3-10,12H2,1-2H3 |
| InChIKey | VRGBVVJPEITRPX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|