C14H25ClN4 — CID 43217592
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine (PubChem CID 43217592) has the molecular formula C14H25ClN4 and a molecular weight of 284.83 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 43217592 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine |
| SMILES | CC1CCCCN1CCCNCc1ncc(Cl)n1C |
| InChI | InChI=1S/C14H25ClN4/c1-12-6-3-4-8-19(12)9-5-7-16-11-14-17-10-13(15)18(14)2/h10,12,16H,3-9,11H2,1-2H3 |
| InChIKey | GKEOYNLVARFERS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|