C9H16ClN3 — CID 43088016
N-[(5-chloro-1-methylimidazol-2-yl)methyl]butan-1-amine (PubChem CID 43088016) has the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]butan-1-amine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 43088016 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]butan-1-amine |
| SMILES | CCCCNCc1ncc(Cl)n1C |
| InChI | InChI=1S/C9H16ClN3/c1-3-4-5-11-7-9-12-6-8(10)13(9)2/h6,11H,3-5,7H2,1-2H3 |
| InChIKey | ZNYYYLDLNZZLEB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|