C11H20ClN3 — CID 115756655
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-2-ethylbutan-1-amine (PubChem CID 115756655) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-2-ethylbutan-1-amine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 115756655 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)CNCc1ncc(Cl)n1C |
| InChI | InChI=1S/C11H20ClN3/c1-4-9(5-2)6-13-8-11-14-7-10(12)15(11)3/h7,9,13H,4-6,8H2,1-3H3 |
| InChIKey | VXMHHYHEKARGIM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |