C15H27N3S — CID 60777015
N'-cyclohexyl-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine (PubChem CID 60777015) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60777015 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propane-1,3-diamine |
| SMILES | Cc1ncc(CNCCCN(C)C2CCCCC2)s1 |
| InChI | InChI=1S/C15H27N3S/c1-13-17-12-15(19-13)11-16-9-6-10-18(2)14-7-4-3-5-8-14/h12,14,16H,3-11H2,1-2H3 |
| InChIKey | HBVDFQUGPWTOKF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|