C17H27FN2 — CID 60733037
N'-cyclohexyl-N-[(3-fluorophenyl)methyl]-N'-methylpropane-1,3-diamine (PubChem CID 60733037) has the molecular formula C17H27FN2 and a molecular weight of 278.41 g/mol. Its IUPAC name is N'-cyclohexyl-N-[(3-fluorophenyl)methyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N-[(3-fluorophenyl)methyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60733037 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | N'-cyclohexyl-N-[(3-fluorophenyl)methyl]-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1cccc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H27FN2/c1-20(17-9-3-2-4-10-17)12-6-11-19-14-15-7-5-8-16(18)13-15/h5,7-8,13,17,19H,2-4,6,9-12,14H2,1H3 |
| InChIKey | UGFJFIVFSZKDGF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|