C16H26BrN3 — CID 115938175
N-[(6-bromo-2-pyridinyl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 115938175) has the molecular formula C16H26BrN3 and a molecular weight of 340.31 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115938175 |
| Molecular Formula | C16H26BrN3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1cccc(Br)n1)C1CCCCC1 |
| InChI | InChI=1S/C16H26BrN3/c1-20(15-8-3-2-4-9-15)12-6-11-18-13-14-7-5-10-16(17)19-14/h5,7,10,15,18H,2-4,6,8-9,11-13H2,1H3 |
| InChIKey | JRBMEJLLRWPDDM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|