C14H20Br2N2 — CID 107938811
N-[(2,4-dibromophenyl)methyl]-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 107938811) has the molecular formula C14H20Br2N2 and a molecular weight of 376.14 g/mol. Its IUPAC name is N-[(2,4-dibromophenyl)methyl]-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-[(2,4-dibromophenyl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 107938811 |
| Molecular Formula | C14H20Br2N2 |
| Molecular Weight | 376.14 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-[(2,4-dibromophenyl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | Brc1ccc(CNCCCN2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H20Br2N2/c15-13-5-4-12(14(16)10-13)11-17-6-3-9-18-7-1-2-8-18/h4-5,10,17H,1-3,6-9,11H2 |
| InChIKey | CIGXAYGOGOFTIJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.14 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|