C15H22BrFN2 — CID 107951107
N-[(3-bromo-2-fluorophenyl)methyl]-3-piperidin-1-ylpropan-1-amine (PubChem CID 107951107) has the molecular formula C15H22BrFN2 and a molecular weight of 329.26 g/mol. Its IUPAC name is N-[(3-bromo-2-fluorophenyl)methyl]-3-piperidin-1-ylpropan-1-amine.
| Compound Name | N-[(3-bromo-2-fluorophenyl)methyl]-3-piperidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 107951107 |
| Molecular Formula | C15H22BrFN2 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[(3-bromo-2-fluorophenyl)methyl]-3-piperidin-1-ylpropan-1-amine |
| SMILES | Fc1c(Br)cccc1CNCCCN1CCCCC1 |
| InChI | InChI=1S/C15H22BrFN2/c16-14-7-4-6-13(15(14)17)12-18-8-5-11-19-9-2-1-3-10-19/h4,6-7,18H,1-3,5,8-12H2 |
| InChIKey | WRVYWYSVMHGGCD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|