C17H28N2 — CID 54941227
N-[(2,3-dimethylphenyl)methyl]-3-piperidin-1-ylpropan-1-amine (PubChem CID 54941227) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)methyl]-3-piperidin-1-ylpropan-1-amine.
| Compound Name | N-[(2,3-dimethylphenyl)methyl]-3-piperidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 54941227 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[(2,3-dimethylphenyl)methyl]-3-piperidin-1-ylpropan-1-amine |
| SMILES | Cc1cccc(CNCCCN2CCCCC2)c1C |
| InChI | InChI=1S/C17H28N2/c1-15-8-6-9-17(16(15)2)14-18-10-7-13-19-11-4-3-5-12-19/h6,8-9,18H,3-5,7,10-14H2,1-2H3 |
| InChIKey | KDKDKYSDYCMFMG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|