C15H24N2 — CID 62331138
2,6-dimethyl-N-(3-pyrrolidin-1-ylpropyl)aniline (PubChem CID 62331138) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,6-dimethyl-N-(3-pyrrolidin-1-ylpropyl)aniline.
| Compound Name | 2,6-dimethyl-N-(3-pyrrolidin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 62331138 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2,6-dimethyl-N-(3-pyrrolidin-1-ylpropyl)aniline |
| SMILES | Cc1cccc(C)c1NCCCN1CCCC1 |
| InChI | InChI=1S/C15H24N2/c1-13-7-5-8-14(2)15(13)16-9-6-12-17-10-3-4-11-17/h5,7-8,16H,3-4,6,9-12H2,1-2H3 |
| InChIKey | FBKCAWIJNDMXLX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|