C13H18Cl2N2 — CID 65498984
2,6-dichloro-N-(3-pyrrolidin-1-ylpropyl)aniline (PubChem CID 65498984) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-pyrrolidin-1-ylpropyl)aniline.
| Compound Name | 2,6-dichloro-N-(3-pyrrolidin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 65498984 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,6-dichloro-N-(3-pyrrolidin-1-ylpropyl)aniline |
| SMILES | Clc1cccc(Cl)c1NCCCN1CCCC1 |
| InChI | InChI=1S/C13H18Cl2N2/c14-11-5-3-6-12(15)13(11)16-7-4-10-17-8-1-2-9-17/h3,5-6,16H,1-2,4,7-10H2 |
| InChIKey | KOZZIEUOGYRESH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|