C13H17Cl2FN2 — CID 107574009
3,5-dichloro-4-fluoro-N-(3-pyrrolidin-1-ylpropyl)aniline (PubChem CID 107574009) has the molecular formula C13H17Cl2FN2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-(3-pyrrolidin-1-ylpropyl)aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-(3-pyrrolidin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 107574009 |
| Molecular Formula | C13H17Cl2FN2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-(3-pyrrolidin-1-ylpropyl)aniline |
| SMILES | Fc1c(Cl)cc(NCCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C13H17Cl2FN2/c14-11-8-10(9-12(15)13(11)16)17-4-3-7-18-5-1-2-6-18/h8-9,17H,1-7H2 |
| InChIKey | CJOUGYSXLZJTCX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|