C13H18Cl2FN3 — CID 107573794
3,5-dichloro-4-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]aniline (PubChem CID 107573794) has the molecular formula C13H18Cl2FN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107573794 |
| Molecular Formula | C13H18Cl2FN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[2-(4-methylpiperazin-1-yl)ethyl]aniline |
| SMILES | CN1CCN(CCNc2cc(Cl)c(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2FN3/c1-18-4-6-19(7-5-18)3-2-17-10-8-11(14)13(16)12(15)9-10/h8-9,17H,2-7H2,1H3 |
| InChIKey | CKCVPWQFTQLHMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|