C17H24Cl2N2O — CID 112764661
N-[3-(azepan-1-yl)propyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 112764661) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 112764661 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C17H24Cl2N2O/c18-15-7-5-8-16(19)14(15)13-17(22)20-9-6-12-21-10-3-1-2-4-11-21/h5,7-8H,1-4,6,9-13H2,(H,20,22) |
| InChIKey | XBSNLSGRYRRASE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|