C18H26Cl2N2OS — CID 99951347
N-[3-(azepan-1-yl)propyl]-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 99951347) has the molecular formula C18H26Cl2N2OS and a molecular weight of 389.39 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 99951347 |
| Molecular Formula | C18H26Cl2N2OS |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)c(Cl)c1)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C18H26Cl2N2OS/c19-16-7-6-15(12-17(16)20)13-24-14-18(23)21-8-5-11-22-9-3-1-2-4-10-22/h6-7,12H,1-5,8-11,13-14H2,(H,21,23) |
| InChIKey | DAEIPWVKZAHCOI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|