C20H26Cl2N2O — CID 10110361
(2E,4E)-6-(3,4-dichlorophenyl)-N-(3-piperidin-1-ylpropyl)hexa-2,4-dienamide (PubChem CID 10110361) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is (2E,4E)-6-(3,4-dichlorophenyl)-N-(3-piperidin-1-ylpropyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-6-(3,4-dichlorophenyl)-N-(3-piperidin-1-ylpropyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 10110361 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2E,4E)-6-(3,4-dichlorophenyl)-N-(3-piperidin-1-ylpropyl)hexa-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/Cc1ccc(Cl)c(Cl)c1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C20H26Cl2N2O/c21-18-11-10-17(16-19(18)22)8-3-1-4-9-20(25)23-12-7-15-24-13-5-2-6-14-24/h1,3-4,9-11,16H,2,5-8,12-15H2,(H,23,25)/b3-1+,9-4+ |
| InChIKey | IGYZIUZTLVFLKS-PTESOZBDSA-N |
| XLogP | 4.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|