C18H22Cl2N2O2 — CID 10270426
(2E,4E)-5-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)penta-2,4-dienamide (PubChem CID 10270426) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is (2E,4E)-5-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 10270426 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (2E,4E)-5-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccc(Cl)c(Cl)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H22Cl2N2O2/c19-16-7-6-15(14-17(16)20)4-1-2-5-18(23)21-8-3-9-22-10-12-24-13-11-22/h1-2,4-7,14H,3,8-13H2,(H,21,23)/b4-1+,5-2+ |
| InChIKey | NCPUGNZSUOHSQQ-GRSRPBPQSA-N |
| XLogP | 3.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|