C17H21Cl2N3O — CID 85073781
5-(3,4-dichlorophenyl)-N-(2-piperazin-1-ylethyl)penta-2,4-dienamide (PubChem CID 85073781) has the molecular formula C17H21Cl2N3O and a molecular weight of 354.28 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(2-piperazin-1-ylethyl)penta-2,4-dienamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(2-piperazin-1-ylethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 85073781 |
| Molecular Formula | C17H21Cl2N3O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(2-piperazin-1-ylethyl)penta-2,4-dienamide |
| SMILES | O=C(C=CC=Cc1ccc(Cl)c(Cl)c1)NCCN1CCNCC1 |
| InChI | InChI=1S/C17H21Cl2N3O/c18-15-6-5-14(13-16(15)19)3-1-2-4-17(23)21-9-12-22-10-7-20-8-11-22/h1-6,13,20H,7-12H2,(H,21,23) |
| InChIKey | DHWCZDSDXFEEOE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|