C16H23Cl2NOS — CID 17309862
2-[(3,4-dichlorophenyl)methylsulfanyl]-N-heptylacetamide (PubChem CID 17309862) has the molecular formula C16H23Cl2NOS and a molecular weight of 348.34 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-heptylacetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-heptylacetamide |
|---|---|
| PubChem CID | 17309862 |
| Molecular Formula | C16H23Cl2NOS |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-heptylacetamide |
| SMILES | CCCCCCCNC(=O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NOS/c1-2-3-4-5-6-9-19-16(20)12-21-11-13-7-8-14(17)15(18)10-13/h7-8,10H,2-6,9,11-12H2,1H3,(H,19,20) |
| InChIKey | LFHMNCWAGCKCGN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|