C20H22Cl2N2O2S — CID 17310014
N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 17310014) has the molecular formula C20H22Cl2N2O2S and a molecular weight of 425.38 g/mol. Its IUPAC name is N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17310014 |
| Molecular Formula | C20H22Cl2N2O2S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-butyl-2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O2S/c1-2-3-10-23-20(26)15-6-4-5-7-18(15)24-19(25)13-27-12-14-8-9-16(21)17(22)11-14/h4-9,11H,2-3,10,12-13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | CGGGKORLBKVHOY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|