C12H15BrCl2N2 — CID 114014994
4-bromo-2,6-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline (PubChem CID 114014994) has the molecular formula C12H15BrCl2N2 and a molecular weight of 338.08 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 114014994 |
| Molecular Formula | C12H15BrCl2N2 |
| Molecular Weight | 338.08 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NCCN1CCCC1 |
| InChI | InChI=1S/C12H15BrCl2N2/c13-9-7-10(14)12(11(15)8-9)16-3-6-17-4-1-2-5-17/h7-8,16H,1-6H2 |
| InChIKey | OTTDXNOAMCVJEX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |