C14H21ClN2 — CID 82088072
2-chloro-4,6-dimethyl-N-(2-pyrrolidin-1-ylethyl)aniline (PubChem CID 82088072) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 2-chloro-4,6-dimethyl-N-(2-pyrrolidin-1-ylethyl)aniline.
| Compound Name | 2-chloro-4,6-dimethyl-N-(2-pyrrolidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 82088072 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-chloro-4,6-dimethyl-N-(2-pyrrolidin-1-ylethyl)aniline |
| SMILES | Cc1cc(C)c(NCCN2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2/c1-11-9-12(2)14(13(15)10-11)16-5-8-17-6-3-4-7-17/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | DWWOPYRFSQUKRN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |