C16H26N2 — CID 54807240
N-[2-(azepan-1-yl)ethyl]-2,6-dimethylaniline (PubChem CID 54807240) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-2,6-dimethylaniline.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 54807240 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NCCN1CCCCCC1 |
| InChI | InChI=1S/C16H26N2/c1-14-8-7-9-15(2)16(14)17-10-13-18-11-5-3-4-6-12-18/h7-9,17H,3-6,10-13H2,1-2H3 |
| InChIKey | ZDVXNHIROTZSMZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |