C15H20ClN3O — CID 115602928
4-chloro-2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenol (PubChem CID 115602928) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 4-chloro-2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenol.
| Compound Name | 4-chloro-2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenol |
|---|---|
| PubChem CID | 115602928 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-chloro-2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenol |
| SMILES | Cc1cc(C)n(CCCNCc2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C15H20ClN3O/c1-11-8-12(2)19(18-11)7-3-6-17-10-13-9-14(16)4-5-15(13)20/h4-5,8-9,17,20H,3,6-7,10H2,1-2H3 |
| InChIKey | HIIBCWNKXQYQKR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|