C16H24Cl2N2O — CID 60931668
2-[[(1-tert-butylpiperidin-4-yl)amino]methyl]-4,6-dichlorophenol (PubChem CID 60931668) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[[(1-tert-butylpiperidin-4-yl)amino]methyl]-4,6-dichlorophenol.
| Compound Name | 2-[[(1-tert-butylpiperidin-4-yl)amino]methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 60931668 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[[(1-tert-butylpiperidin-4-yl)amino]methyl]-4,6-dichlorophenol |
| SMILES | CC(C)(C)N1CCC(NCc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C16H24Cl2N2O/c1-16(2,3)20-6-4-13(5-7-20)19-10-11-8-12(17)9-14(18)15(11)21/h8-9,13,19,21H,4-7,10H2,1-3H3 |
| InChIKey | ASGRHQAWBMTMLU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|