C16H15Cl3N2O3 — CID 26251366
2-(2-ethoxyphenoxy)-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 26251366) has the molecular formula C16H15Cl3N2O3 and a molecular weight of 389.67 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(2-ethoxyphenoxy)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 26251366 |
| Molecular Formula | C16H15Cl3N2O3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O3/c1-2-23-13-5-3-4-6-14(13)24-9-15(22)20-21-16-11(18)7-10(17)8-12(16)19/h3-8,21H,2,9H2,1H3,(H,20,22) |
| InChIKey | CAPCNIVOMGCXBU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|