C16H14Cl3NO3 — CID 7613010
2-(2-ethoxyphenoxy)-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 7613010) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7613010 |
| Molecular Formula | C16H14Cl3NO3 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3NO3/c1-2-22-13-5-3-4-6-14(13)23-9-15(21)20-16-11(18)7-10(17)8-12(16)19/h3-8H,2,9H2,1H3,(H,20,21) |
| InChIKey | MIVCYLZVEUBGOB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |