C11H11Cl3N6OS — CID 60539641
3-(1-methyltetrazol-5-yl)sulfanyl-N'-(2,4,6-trichlorophenyl)propanehydrazide (PubChem CID 60539641) has the molecular formula C11H11Cl3N6OS and a molecular weight of 381.68 g/mol. Its IUPAC name is 3-(1-methyltetrazol-5-yl)sulfanyl-N'-(2,4,6-trichlorophenyl)propanehydrazide.
| Compound Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N'-(2,4,6-trichlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 60539641 |
| Molecular Formula | C11H11Cl3N6OS |
| Molecular Weight | 381.68 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N'-(2,4,6-trichlorophenyl)propanehydrazide |
| SMILES | Cn1nnnc1SCCC(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N6OS/c1-20-11(17-18-19-20)22-3-2-9(21)15-16-10-7(13)4-6(12)5-8(10)14/h4-5,16H,2-3H2,1H3,(H,15,21) |
| InChIKey | IVEWFSYLLPKXRV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|