C10H14N6OS — CID 71866653
3-(1-methyltetrazol-5-yl)sulfanyl-N-(1H-pyrrol-2-ylmethyl)propanamide (PubChem CID 71866653) has the molecular formula C10H14N6OS and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-(1-methyltetrazol-5-yl)sulfanyl-N-(1H-pyrrol-2-ylmethyl)propanamide.
| Compound Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N-(1H-pyrrol-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 71866653 |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N-(1H-pyrrol-2-ylmethyl)propanamide |
| SMILES | Cn1nnnc1SCCC(=O)NCc1ccc[nH]1 |
| InChI | InChI=1S/C10H14N6OS/c1-16-10(13-14-15-16)18-6-4-9(17)12-7-8-3-2-5-11-8/h2-3,5,11H,4,6-7H2,1H3,(H,12,17) |
| InChIKey | OSHQGYSGBDMARN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |