C11H12ClN5OS — CID 17387870
N-(2-chlorophenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 17387870) has the molecular formula C11H12ClN5OS and a molecular weight of 297.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | N-(2-chlorophenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 17387870 |
| Molecular Formula | C11H12ClN5OS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2-chlorophenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | Cn1nnnc1SCCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN5OS/c1-17-11(14-15-16-17)19-7-6-10(18)13-9-5-3-2-4-8(9)12/h2-5H,6-7H2,1H3,(H,13,18) |
| InChIKey | YDVLPMLSMCHLJO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |