C13H17N5O2S — CID 17387877
N-(2-methoxy-5-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 17387877) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 17387877 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | COc1ccc(C)cc1NC(=O)CCSc1nnnn1C |
| InChI | InChI=1S/C13H17N5O2S/c1-9-4-5-11(20-3)10(8-9)14-12(19)6-7-21-13-15-16-17-18(13)2/h4-5,8H,6-7H2,1-3H3,(H,14,19) |
| InChIKey | JBDWCLONBMVTPI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |