C15H20N6O2S — CID 50972244
N'-(2,4-dimethylphenyl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propanediamide (PubChem CID 50972244) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N'-(2,4-dimethylphenyl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propanediamide.
| Compound Name | N'-(2,4-dimethylphenyl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propanediamide |
|---|---|
| PubChem CID | 50972244 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N'-(2,4-dimethylphenyl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)NCCSc2nnnn2C)c(C)c1 |
| InChI | InChI=1S/C15H20N6O2S/c1-10-4-5-12(11(2)8-10)17-14(23)9-13(22)16-6-7-24-15-18-19-20-21(15)3/h4-5,8H,6-7,9H2,1-3H3,(H,16,22)(H,17,23) |
| InChIKey | LRFZMORYMAMRLK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|