C14H19FN6OS — CID 91789990
2-[(4-fluorophenyl)methyl-methylamino]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]acetamide (PubChem CID 91789990) has the molecular formula C14H19FN6OS and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-methylamino]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 91789990 |
| Molecular Formula | C14H19FN6OS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]acetamide |
| SMILES | CN(CC(=O)NCCSc1nnnn1C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN6OS/c1-20(9-11-3-5-12(15)6-4-11)10-13(22)16-7-8-23-14-17-18-19-21(14)2/h3-6H,7-10H2,1-2H3,(H,16,22) |
| InChIKey | NWCAWZDSIXWPRY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|