C11H15ClFN5S — CID 17291661
N-[(4-fluorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17291661) has the molecular formula C11H15ClFN5S and a molecular weight of 303.79 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17291661 |
| Molecular Formula | C11H15ClFN5S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | Cl.Cn1nnnc1SCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN5S.ClH/c1-17-11(14-15-16-17)18-7-6-13-8-9-2-4-10(12)5-3-9;/h2-5,13H,6-8H2,1H3;1H |
| InChIKey | CMFCFTGPAVMBRF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|