C14H22ClN5S — CID 17060129
N-[(4-ethylphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17060129) has the molecular formula C14H22ClN5S and a molecular weight of 327.89 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[(4-ethylphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17060129 |
| Molecular Formula | C14H22ClN5S |
| Molecular Weight | 327.89 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | CCc1ccc(CNCCCSc2nnnn2C)cc1.Cl |
| InChI | InChI=1S/C14H21N5S.ClH/c1-3-12-5-7-13(8-6-12)11-15-9-4-10-20-14-16-17-18-19(14)2;/h5-8,15H,3-4,9-11H2,1-2H3;1H |
| InChIKey | AXWMLFBFUPUYRA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|