C11H14Cl2N5S- — CID 53346680
N-[(4-chlorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride (PubChem CID 53346680) has the molecular formula C11H14Cl2N5S- and a molecular weight of 319.24 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride |
|---|---|
| PubChem CID | 53346680 |
| Molecular Formula | C11H14Cl2N5S- |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride |
| SMILES | Cn1nnnc1SCCNCc1ccc(Cl)cc1.[Cl-] |
| InChI | InChI=1S/C11H14ClN5S.ClH/c1-17-11(14-15-16-17)18-7-6-13-8-9-2-4-10(12)5-3-9;/h2-5,13H,6-8H2,1H3;1H/p-1 |
| InChIKey | UDGQCZSHSYCFID-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|