C13H17Br2N5OS — CID 17157921
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 17157921) has the molecular formula C13H17Br2N5OS and a molecular weight of 451.19 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 17157921 |
| Molecular Formula | C13H17Br2N5OS |
| Molecular Weight | 451.19 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | CCOc1c(Br)cc(CNCCSc2nnnn2C)cc1Br |
| InChI | InChI=1S/C13H17Br2N5OS/c1-3-21-12-10(14)6-9(7-11(12)15)8-16-4-5-22-13-17-18-19-20(13)2/h6-7,16H,3-5,8H2,1-2H3 |
| InChIKey | VDBOXFYBCLGXHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|