C15H22ClN5O2S — CID 2997126
N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 2997126) has the molecular formula C15H22ClN5O2S and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 2997126 |
| Molecular Formula | C15H22ClN5O2S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)cc(Cl)c1OCC |
| InChI | InChI=1S/C15H22ClN5O2S/c1-4-22-13-9-11(8-12(16)14(13)23-5-2)10-17-6-7-24-15-18-19-20-21(15)3/h8-9,17H,4-7,10H2,1-3H3 |
| InChIKey | GILQMTRDFPSBRO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|