C19H23ClN6O2S — CID 17055849
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 17055849) has the molecular formula C19H23ClN6O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 17055849 |
| Molecular Formula | C19H23ClN6O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)ccc1OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H23ClN6O2S/c1-3-27-17-10-14(11-21-8-9-29-19-23-24-25-26(19)2)4-6-16(17)28-13-15-5-7-18(20)22-12-15/h4-7,10,12,21H,3,8-9,11,13H2,1-2H3 |
| InChIKey | RCVADLCNXZNQHK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|