C19H30N6O3S — CID 4718789
N-tert-butyl-2-[2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide (PubChem CID 4718789) has the molecular formula C19H30N6O3S and a molecular weight of 422.56 g/mol. Its IUPAC name is N-tert-butyl-2-[2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4718789 |
| Molecular Formula | C19H30N6O3S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-tert-butyl-2-[2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)ccc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H30N6O3S/c1-6-27-16-11-14(12-20-9-10-29-18-22-23-24-25(18)5)7-8-15(16)28-13-17(26)21-19(2,3)4/h7-8,11,20H,6,9-10,12-13H2,1-5H3,(H,21,26) |
| InChIKey | QWKFINHZQHXILU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|