About N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride
N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride (PubChem CID 17060165) has the molecular formula C14H24Cl2N6S
and a molecular weight of 379.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride |
| PubChem CID | 17060165 |
| Molecular Formula | C14H24Cl2N6S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride |
| SMILES | CN(C)c1ccc(CNCCCSc2nnnn2C)cc1.Cl.Cl |
| InChI | InChI=1S/C14H22N6S.2ClH/c1-19(2)13-7-5-12(6-8-13)11-15-9-4-10-21-14-16-17-18-20(14)3;;/h5-8,15H,4,9-11H2,1-3H3;2*1H |
| InChIKey | KWNHEGHGZNPQEH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride?
The IUPAC name of N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride (CID 17060165) is N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride.
What is the SMILES notation for N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride?
The canonical SMILES for N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride is CN(C)c1ccc(CNCCCSc2nnnn2C)cc1.Cl.Cl.
What is the InChIKey of N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride?
The InChIKey is KWNHEGHGZNPQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6S.2ClH/c1-19(2)13-7-5-12(6-8-13)11-15-9-4-10-21-14-16-17-18-20(14)3;;/h5-8,15H,4,9-11H2,1-3H3;2*1H.
What are the key properties of N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride?
N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride has a molecular weight of 379.36 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]aniline;dihydrochloride is sourced from PubChem (CID 17060165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).