C16H20ClN5OS2 — CID 17331783
2-(1-methyltetrazol-5-yl)sulfanyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride (PubChem CID 17331783) has the molecular formula C16H20ClN5OS2 and a molecular weight of 397.96 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17331783 |
| Molecular Formula | C16H20ClN5OS2 |
| Molecular Weight | 397.96 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride |
| SMILES | Cl.Cn1nnnc1SCCNCc1ccc(OCc2cccs2)cc1 |
| InChI | InChI=1S/C16H19N5OS2.ClH/c1-21-16(18-19-20-21)24-10-8-17-11-13-4-6-14(7-5-13)22-12-15-3-2-9-23-15;/h2-7,9,17H,8,10-12H2,1H3;1H |
| InChIKey | AABSEFJNYUBZMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.96 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|