C10H15N5S2 — CID 62578123
N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-thiophen-2-ylethanamine (PubChem CID 62578123) has the molecular formula C10H15N5S2 and a molecular weight of 269.40 g/mol. Its IUPAC name is N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62578123 |
| Molecular Formula | C10H15N5S2 |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-thiophen-2-ylethanamine |
| SMILES | Cn1nnnc1SCCNCCc1cccs1 |
| InChI | InChI=1S/C10H15N5S2/c1-15-10(12-13-14-15)17-8-6-11-5-4-9-3-2-7-16-9/h2-3,7,11H,4-6,8H2,1H3 |
| InChIKey | SKCSIZCGZVTZCG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|